| Name | disperse orange 11 |
| Synonyms | CI 60700 disperse orange 11 DISPERSE ORANGE 11 TIMTEC-BB SBB003232 LABOTEST-BB LT00159721 1-Amino-2-Methylanthraquinone 1-AMINO-2-METHYLANTHRAQUINONE 1-amino-2-methyl-10-anthracenedione 1-amino-2-methyl-9,10-anthraquinone 1-amino-2-methyl-9,10-anthracenedione |
| CAS | 82-28-0 |
| EINECS | 201-408-3 |
| InChI | InChI=1/C15H11NO2/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,16H2,1H3 |
| Molecular Formula | C15H11NO2 |
| Molar Mass | 237.25 |
| Density | 1.1469 (rough estimate) |
| Melting Point | 204-206°C(lit.) |
| Boling Point | 379.79°C (rough estimate) |
| Flash Point | 244.8°C |
| Water Solubility | 332.2ug/L(25 ºC) |
| Vapor Presure | 2.05E-09mmHg at 25°C |
| Appearance | neat |
| Color | Orange to Amber to Dark red |
| pKa | -0.53±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents, mineral acids. |
| Refractive Index | 1.5500 (estimate) |
| WGK Germany | 3 |
| RTECS | CB5740000 |
| FLUKA BRAND F CODES | 10-21 |
| Hazard Class | IRRITANT |
| Color index | 60700 |
| (IARC) carcinogen classification | 3 (Vol. 27, Sup 7) 1987 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Application | mainly used for printing and dyeing of polyester and polyester/cotton textiles |
| category | toxic substances |
| flammability hazard characteristics | flammability; Toxic NOx smoke from combustion |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, water mist |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |